4-AcO-EPT
3-{2-[Ethyl(propyl)amino]ethyl}-1H-indol-4-yl acetate
 3361  C17H24N2O2  288.385
 InChI=1S/C17H24N2O2/c1-4-10-19(5-2)11-9-14-12-18-15-7-6-8-16(17(14)15)21-13(3)20/h6-8,12,18H,4-5,9-11H2,1-3H3
 VMFRFQVZMZGHOK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCc1c[nH]c2c1c(ccc2)OC(=O)C)CC