Isomethcathinone
1-(Methylamino)-1-phenylpropan-2-one
 3356 C10H13NO 163.216
 InChI=1S/C10H13NO/c1-8(12)10(11-2)9-6-4-3-5-7-9/h3-7,10-11H,1-2H3
 LNLNWQQWSFMHBW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(c1ccccc1)C(=O)C