4-HO-MALT
3-{2-[Methyl(prop-2-en-1-yl)amino]ethyl}-1H-indol-4-ol
 3340  C14H18N2O  230.306
 InChI=1S/C14H18N2O/c1-3-8-16(2)9-7-11-10-15-12-5-4-6-13(17)14(11)12/h3-6,10,15,17H,1,7-9H2,2H3
 NWEWNVPCYZONHK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCN(CCc1c[nH]c2c1c(O)ccc2)C