8-MeO-THPQ
2-(8-Methoxy-1,2,5,6-tetrahydro-4H-pyrrolo[3,2,1-ij]quinolin-1-yl)ethan-1-amine
 3324 C14H20N2O 232.321
 InChI=1S/C14H20N2O/c1-17-12-7-10-3-2-6-16-9-11(4-5-15)13(8-12)14(10)16/h7-8,11H,2-6,9,15H2,1H3
 TUECGBHUQDYUDQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCC1CN2c3c1cc(OC)cc3CCC2