4,7-MeO-DET
2-(4,7-Dimethoxy-1H-indol-3-yl)-N,N-diethylethan-1-amine
 3317  C16H24N2O2  276.374
 InChI=1S/C16H24N2O2/c1-5-18(6-2)10-9-12-11-17-16-14(20-4)8-7-13(19-3)15(12)16/h7-8,11,17H,5-6,9-10H2,1-4H3
 SRIPRPWSJTYHPJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c[nH]c2c1c(OC)ccc2OC)CC