4,7-MeO-T
2-(4,7-Dimethoxy-1H-indol-3-yl)ethan-1-amine
 3312  C12H16N2O2  220.268
 InChI=1S/C12H16N2O2/c1-15-9-3-4-10(16-2)12-11(9)8(5-6-13)7-14-12/h3-4,7,14H,5-6,13H2,1-2H3
 PZKYHKZYACYPAZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c[nH]c2c1c(OC)ccc2OC