5-MeO-7-Me-T
2-(5-Methoxy-7-methyl-1H-indol-3-yl)ethan-1-amine
 3308  C12H16N2O  204.268
 InChI=1S/C12H16N2O/c1-8-5-10(15-2)6-11-9(3-4-13)7-14-12(8)11/h5-7,14H,3-4,13H2,1-2H3
 WSFFDYOVPGVTEE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c[nH]c2c1cc(OC)cc2C