Properidine
Propan-2-yl 1-methyl-4-phenylpiperidine-4-carboxylate
 3268 C16H23NO2 261.359
 InChI=1S/C16H23NO2/c1-13(2)19-15(18)16(9-11-17(3)12-10-16)14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3
 XJKQCILVUHXVIQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1CCC(CC1)(C(=O)OC(C)C)c1ccccc1