Betaprodine
(3S,4S)-1,3-Dimethyl-4-phenylpiperidin-4-yl propanoate
 3255 C16H23NO2 261.359
 InChI=1S/C16H23NO2/c1-4-15(18)19-16(14-8-6-5-7-9-14)10-11-17(3)12-13(16)2/h5-9,13H,4,10-12H2,1-3H3/t13-,16-/m0/s1
 UVAZQQHAVMNMHE-BBRMVZONSA-N This stereoisomer Any stereoisomer
 CCC(=O)O[C@]1(CCN(C[C@@H]1C)C)c1ccccc1