1-(4-Methylphenyl)-2-(piperidin-1-yl)propan-1-one
 3239 C15H21NO 231.333
 InChI=1S/C15H21NO/c1-12-6-8-14(9-7-12)15(17)13(2)16-10-4-3-5-11-16/h6-9,13H,3-5,10-11H2,1-2H3
 DHZOVKWINAURCF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(=O)c1ccc(cc1)C)N1CCCCC1