N-methyl-1-phenylpropylamine
N-Methyl-1-phenylpropan-1-amine
 3237 C10H15N 149.233
 InChI=1S/C10H15N/c1-3-10(11-2)9-7-5-4-6-8-9/h4-8,10-11H,3H2,1-2H3
 YELGXBUYFOSFJM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(c1ccccc1)NC