Norfentanyl
N-Phenyl-N-(piperidin-4-yl)propanamide
 3157 C14H20N2O 232.321
 Fentanyl
 InChI=1S/C14H20N2O/c1-2-14(17)16(12-6-4-3-5-7-12)13-8-10-15-11-9-13/h3-7,13,15H,2,8-11H2,1H3
 PMCBDBWCQQBSRJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)N(c1ccccc1)C1CCNCC1