6-MeO-DIPT
N-[2-(6-Methoxy-1H-indol-3-yl)ethyl]-N-(propan-2-yl)propan-2-amine
 3080  C17H26N2O  274.401
 InChI=1S/C17H26N2O/c1-12(2)19(13(3)4)9-8-14-11-18-17-10-15(20-5)6-7-16(14)17/h6-7,10-13,18H,8-9H2,1-5H3
 VVHSFCPALYIWMT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)[nH]cc2CCN(C(C)C)C(C)C