3,4-Trimethylenepentedrone
1-(2,3-Dihydro-1H-inden-5-yl)-2-(methylamino)pentan-1-one
 2989 C15H21NO 231.333
 InChI=1S/C15H21NO/c1-3-5-14(16-2)15(17)13-9-8-11-6-4-7-12(11)10-13/h8-10,14,16H,3-7H2,1-2H3
 ZCTUUSNQUQURDL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1ccc2c(c1)CCC2)NC