MCPT
N-[2-(1H-Indol-3-yl)ethyl]-N-methylcyclopropanamine
 2968  C14H18N2  214.306
 InChI=1S/C14H18N2/c1-16(12-6-7-12)9-8-11-10-15-14-5-3-2-4-13(11)14/h2-5,10,12,15H,6-9H2,1H3
 LVOSBNVSQLXACL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C1CC1)CCc1c[nH]c2c1cccc2