4-Hydroxymethyl-DMT
{3-[2-(Dimethylamino)ethyl]-1H-indol-4-yl}methanol
 2962  C13H18N2O  218.295
 Prophetic?
 InChI=1S/C13H18N2O/c1-15(2)7-6-10-8-14-12-5-3-4-11(9-16)13(10)12/h3-5,8,14,16H,6-7,9H2,1-2H3
 IWLCANDLGIAGGG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OCc1cccc2c1c(CCN(C)C)c[nH]2