N-Methyl-N-(2-phenylethyl)propan-2-amine
 2927 C12H19N 177.286
 InChI=1S/C12H19N/c1-11(2)13(3)10-9-12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3
 HJLQPXCLODDOHV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N(CCc1ccccc1)C)C