α-Methoxy-2C-D
2-(2,5-Dimethoxy-4-methylphenyl)-1-methoxyethan-1-amine
 2923 C12H19NO3 225.284
 InChI=1S/C12H19NO3/c1-8-5-11(15-3)9(6-10(8)14-2)7-12(13)16-4/h5-6,12H,7,13H2,1-4H3
 BHEMAYQMWXUXEV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COC(Cc1cc(OC)c(cc1OC)C)N