1-Methyl-4,5-DHP-AMT
1-(3-Methyl-3,7,8,9-tetrahydropyrano[3,2-e]indol-1-yl)propan-2-amine
 2893  C15H20N2O  244.332
 InChI=1S/C15H20N2O/c1-10(16)8-11-9-17(2)13-5-6-14-12(15(11)13)4-3-7-18-14/h5-6,9-10H,3-4,7-8,16H2,1-2H3
 HPEOSNKVEAJRAK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cn(c2c1c1CCCOc1cc2)C)N