HOT-E
2-(4-Ethyl-2,5-dimethoxyphenyl)-N-hydroxyethan-1-amine
 2832 C12H19NO3 225.284
 InChI=1S/C12H19NO3/c1-4-9-7-12(16-3)10(5-6-13-14)8-11(9)15-2/h7-8,13-14H,4-6H2,1-3H3
 AMSDRKAGBVCJNP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ONCCc1cc(OC)c(cc1OC)CC