N-[2-(1H-Indol-4-yl)ethyl]propan-1-amine
 2780 C13H18N2 202.295
 InChI=1S/C13H18N2/c1-2-8-14-9-6-11-4-3-5-13-12(11)7-10-15-13/h3-5,7,10,14-15H,2,6,8-9H2,1H3
 KEICWHLCVKDMHP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNCCc1cccc2c1cc[nH]2