2,3,4,5-Tetrahydro-1H-3-benzazepine
 2754 C10H13N 147.217
 InChI=1S/C10H13N/c1-2-4-10-6-8-11-7-5-9(10)3-1/h1-4,11H,5-8H2
 MWVMYAWMFTVYED-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N1CCc2c(CC1)cccc2