Lorcaserin
8-Chloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine
 2727  C11H14ClN  195.689
 InChI=1S/C11H14ClN/c1-8-7-13-5-4-9-2-3-10(12)6-11(8)9/h2-3,6,8,13H,4-5,7H2,1H3
 XTTZERNUQAFMOF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Clc1ccc2c(c1)C(C)CNCC2