3-NO2-PMeA
1-(4-Methyl-3-nitrophenyl)propan-2-amine
 2665  C10H14N2O2  194.23
 InChI=1S/C10H14N2O2/c1-7-3-4-9(5-8(2)11)6-10(7)12(13)14/h3-4,6,8H,5,11H2,1-2H3
 QKOGBZBJJILSLV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(c(c1)N(=O)=O)C)N