NO2-EOMA
1-(4-Ethoxy-5-methoxy-2-nitrophenyl)propan-2-amine
 2659  C12H18N2O4  254.282
 InChI=1S/C12H18N2O4/c1-4-18-12-7-10(14(15)16)9(5-8(2)13)6-11(12)17-3/h6-8H,4-5,13H2,1-3H3
 YZGYJAVOJSUAPZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(N(=O)=O)c(cc1OC)CC(N)C