PEA-NBOH
2-{[(2-Phenylethyl)amino]methyl}phenol
 2647  C15H17NO  227.302
 InChI=1S/C15H17NO/c17-15-9-5-4-8-14(15)12-16-11-10-13-6-2-1-3-7-13/h1-9,16-17H,10-12H2
 YPHHNRQCFHGFFR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Oc1ccccc1CNCCc1ccccc1