MTHPI
3-(1-Methyl-1,2,3,6-tetrahydropyridin-4-yl)-1H-indole
 2613 C14H16N2 212.29
 InChI=1S/C14H16N2/c1-16-8-6-11(7-9-16)13-10-15-14-5-3-2-4-12(13)14/h2-6,10,15H,7-9H2,1H3
 IUENQRYBZHHPBN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1CCC(=CC1)c1c[nH]c2c1cccc2