5-BnO-DPT
N-{2-[4-(Benzyloxy)-1H-indol-3-yl]ethyl}-N-propylpropan-1-amine
 2608 C23H30N2O 350.497
 InChI=1S/C23H30N2O/c1-3-14-25(15-4-2)16-13-20-17-24-21-11-8-12-22(23(20)21)26-18-19-9-6-5-7-10-19/h5-12,17,24H,3-4,13-16,18H2,1-2H3
 NUVORDRETOXRRS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCc1c[nH]c2c1c(ccc2)OCc1ccccc1)CCC