3-MeO-N,N,4-MePEA
2-(3-Methoxy-4-methylphenyl)-N,N-dimethylethan-1-amine
 2523 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-10-5-6-11(7-8-13(2)3)9-12(10)14-4/h5-6,9H,7-8H2,1-4H3
 UZDDHIUZOPASLH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CCN(C)C)ccc1C