5-BzO-2-MPEA
2-[5-(Benzyloxy)-2-methoxyphenyl]ethan-1-amine
 2494  C16H19NO2  257.328
 InChI=1S/C16H19NO2/c1-18-16-8-7-15(11-14(16)9-10-17)19-12-13-5-3-2-4-6-13/h2-8,11H,9-10,12,17H2,1H3
 LPXOPDKFARVIQB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OCc2ccccc2)ccc1OC