4-Bz-2-MPEA
2-(4-Benzyl-2-methoxyphenyl)ethan-1-amine
 2484  C16H19NO  241.328
 InChI=1S/C16H19NO/c1-18-16-12-14(7-8-15(16)9-10-17)11-13-5-3-2-4-6-13/h2-8,12H,9-11,17H2,1H3
 GZYAWROTEPNHRQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1OC)Cc1ccccc1