2,4-Dimethoxycathinone
2-Amino-1-(3,5-dimethoxyphenyl)propan-1-one
 2459 C11H15NO3 209.242
 InChI=1S/C11H15NO3/c1-7(12)11(13)8-4-9(14-2)6-10(5-8)15-3/h4-7H,12H2,1-3H3
 LNVCGCSMXLDZRZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC)cc(c1)C(=O)C(N)C