DOB-OH
1-(4-Bromo-2,5-dimethoxyphenyl)-N-hydroxypropan-2-amine
 2429  C11H16BrNO3  290.154
 InChI=1S/C11H16BrNO3/c1-7(13-14)4-8-5-11(16-3)9(12)6-10(8)15-2/h5-7,13-14H,4H2,1-3H3
 MLKRRZYMIHQRHE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ONC(Cc1cc(OC)c(cc1OC)Br)C