4-Methylnorephedrine
2-Amino-1-(4-methylphenyl)propan-1-ol
 2404 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-7-3-5-9(6-4-7)10(12)8(2)11/h3-6,8,10,12H,11H2,1-2H3
 HYFSOKGGCDALKV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(c1ccc(cc1)C)O)N