4-Butylthionorephedrine
2-Amino-1-[4-(butylsulfanyl)phenyl]propan-1-ol
 2403  C13H21NOS  239.377
 InChI=1S/C13H21NOS/c1-3-4-9-16-12-7-5-11(6-8-12)13(15)10(2)14/h5-8,10,13,15H,3-4,9,14H2,1-2H3
 HYWHUMBPUUXHHR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCSc1ccc(cc1)C(C(N)C)O