4-Propoxynorephedrine
2-Amino-1-(4-propoxyphenyl)propan-1-ol
 2398 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-3-8-15-11-6-4-10(5-7-11)12(14)9(2)13/h4-7,9,12,14H,3,8,13H2,1-2H3
 LYPNBFCLXLXQAJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc(cc1)C(C(N)C)O