4-Ethoxycathinone
2-Amino-1-(4-ethoxyphenyl)propan-1-one
 2383 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-3-14-10-6-4-9(5-7-10)11(13)8(2)12/h4-8H,3,12H2,1-2H3
 NYVVSPUJQHVIMQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(cc1)C(=O)C(N)C