2-Methyl-THIQ
2-Methyl-1,2,3,4-tetrahydroisoquinoline
 2285 C10H13N 147.217
 InChI=1S/C10H13N/c1-11-7-6-9-4-2-3-5-10(9)8-11/h2-5H,6-8H2,1H3
 KYXSVGVQGFPNRQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1CCc2c(C1)cccc2