DMHM-4
6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinoline
 2277 C12H17NO2 207.269
 InChI=1S/C12H17NO2/c1-13-5-4-9-6-11(14-2)12(15-3)7-10(9)8-13/h6-7H,4-5,8H2,1-3H3
 TXPPKWZEHFNZOE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc2CN(C)CCc2cc1OC