Uberine
5-Methoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-7-ol
 2267 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-12-4-3-10-8(7-12)5-9(13)6-11(10)14-2/h5-6,13H,3-4,7H2,1-2H3
 WWHAMQKZDMJLLC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(O)cc2c1CCN(C2)C