Longimammidine
2-Methyl-1,2,3,4-tetrahydroisoquinolin-8-ol
 2265 C10H13NO 163.216
 InChI=1S/C10H13NO/c1-11-6-5-8-3-2-4-10(12)9(8)7-11/h2-4,12H,5-7H2,1H3
 SVLXGEARAXXBSX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1CCc2c(C1)c(O)ccc2