Longimammatine
6-Methoxy-1,2,3,4-tetrahydroisoquinoline
 2262 C10H13NO 163.216
 InChI=1S/C10H13NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-3,6,11H,4-5,7H2,1H3
 YYTAYINRPUJPNH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)CCNC2