Longimammosine
2-Methyl-1,2,3,4-tetrahydroisoquinolin-6-ol
 2261 C10H13NO 163.216
 InChI=1S/C10H13NO/c1-11-5-4-8-6-10(12)3-2-9(8)7-11/h2-3,6,12H,4-5,7H2,1H3
 BMLTXAQSFDCMHA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1CCc2c(C1)ccc(c2)O