2-Methyl-1-(4-methylphenyl)-2-(pyrrolidin-1-yl)propan-1-one
 2120 C15H21NO 231.333
 InChI=1S/C15H21NO/c1-12-6-8-13(9-7-12)14(17)15(2,3)16-10-4-5-11-16/h6-9H,4-5,10-11H2,1-3H3
 YMGQEFUZLVESMR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(C(N1CCCC1)(C)C)c1ccc(cc1)C