2,4-Diethoxy-N,N-dimethylamphetamine
1-(2,4-Diethoxyphenyl)-N,N-dimethylpropan-2-amine
 2104 C15H25NO2 251.365
 Peyote alkaloid
 InChI=1S/C15H25NO2/c1-6-17-14-9-8-13(10-12(3)16(4)5)15(11-14)18-7-2/h8-9,11-12H,6-7,10H2,1-5H3
 AOFCMNFNTVDKJL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(OCC)ccc1CC(N(C)C)C