2-n-Butyloxy-4-methoxy-N,N-dimethylamphetamine
1-(2-Butoxy-4-methoxyphenyl)-N,N-dimethylpropan-2-amine
 2102 C16H27NO2 265.391
 InChI=1S/C16H27NO2/c1-6-7-10-19-16-12-15(18-5)9-8-14(16)11-13(2)17(3)4/h8-9,12-13H,6-7,10-11H2,1-5H3
 MJXUCWMWXPIWFS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCOc1cc(OC)ccc1CC(N(C)C)C