N,N-Dimethyl-2-ethoxy-4-methoxyamphetamine
1-(2-Ethoxy-4-methoxyphenyl)-N,N-dimethylpropan-2-amine
 2101 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-6-17-14-10-13(16-5)8-7-12(14)9-11(2)15(3)4/h7-8,10-11H,6,9H2,1-5H3
 ASGUVBWUSSFSOF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(OC)ccc1CC(N(C)C)C