N,N-Dimethyl-4-methoxy-2,3-(trimethylene)amphetamine
1-(7-Methoxy-2,3-dihydro-1H-inden-4-yl)-N,N-dimethylpropan-2-amine
 2060 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-11(16(2)3)10-12-8-9-15(17-4)14-7-5-6-13(12)14/h8-9,11H,5-7,10H2,1-4H3
 FDYPLHIVAJWJFL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c2c1CCC2)CC(N(C)C)C