DOM-FLY
1-(8-Methyl-2,3,6,7-tetrahydrobenzo[1,2-b:4,5-b′]difuran-4-yl)propan-2-amine
 2024 C14H19NO2 233.306
 InChI=1S/C14H19NO2/c1-8(15)7-12-11-4-6-16-13(11)9(2)10-3-5-17-14(10)12/h8H,3-7,15H2,1-2H3
 VZVQYRAMKUVLKJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c2OCCc2c(c2c1CCO2)C)N