N-Allylmethylone
1-(2H-1,3-Benzodioxol-5-yl)-2-[methyl(prop-2-en-1-yl)amino]propan-1-one
 1967  C14H17NO3  247.29
 InChI=1S/C14H17NO3/c1-4-7-15(3)10(2)14(16)11-5-6-12-13(8-11)18-9-17-12/h4-6,8,10H,1,7,9H2,2-3H3
 TTZYRCQMBVFFQQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCN(C(C(=O)c1ccc2c(c1)OCO2)C)C